C35H31ClN6O — CID 10438327
2-butyl-5-chloro-3-[[4-(2-trityltetrazol-5-yl)phenyl]methyl]imidazole-4-carbaldehyde (PubChem CID 10438327) has the molecular formula C35H31ClN6O and a molecular weight of 587.13 g/mol. Its IUPAC name is 2-butyl-5-chloro-3-[[4-(2-trityltetrazol-5-yl)phenyl]methyl]imidazole-4-carbaldehyde.
| Compound Name | 2-butyl-5-chloro-3-[[4-(2-trityltetrazol-5-yl)phenyl]methyl]imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 10438327 |
| Molecular Formula | C35H31ClN6O |
| Molecular Weight | 587.13 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 2-butyl-5-chloro-3-[[4-(2-trityltetrazol-5-yl)phenyl]methyl]imidazole-4-carbaldehyde |
| SMILES | CCCCc1nc(Cl)c(C=O)n1Cc1ccc(-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C35H31ClN6O/c1-2-3-19-32-37-33(36)31(25-43)41(32)24-26-20-22-27(23-21-26)34-38-40-42(39-34)35(28-13-7-4-8-14-28,29-15-9-5-10-16-29)30-17-11-6-12-18-30/h4-18,20-23,25H,2-3,19,24H2,1H3 |
| InChIKey | RKJNWBOJBVSGOG-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.13 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|