C30H26ClN7O6 — CID 143266639
[4-(nitrooxymethyl)phenyl] 5-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]tetrazole-2-carboxylate (PubChem CID 143266639) has the molecular formula C30H26ClN7O6 and a molecular weight of 616.03 g/mol. Its IUPAC name is [4-(nitrooxymethyl)phenyl] 5-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]tetrazole-2-carboxylate.
| Compound Name | [4-(nitrooxymethyl)phenyl] 5-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]tetrazole-2-carboxylate |
|---|---|
| PubChem CID | 143266639 |
| Molecular Formula | C30H26ClN7O6 |
| Molecular Weight | 616.03 g/mol |
| Exact Mass | 615.16 |
| IUPAC Name | [4-(nitrooxymethyl)phenyl] 5-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]tetrazole-2-carboxylate |
| SMILES | CCCCc1nc(Cl)c(C=O)n1Cc1ccc(-c2ccccc2-c2nnn(C(=O)Oc3ccc(CO[N+](=O)[O-])cc3)n2)cc1 |
| InChI | InChI=1S/C30H26ClN7O6/c1-2-3-8-27-32-28(31)26(18-39)36(27)17-20-9-13-22(14-10-20)24-6-4-5-7-25(24)29-33-35-37(34-29)30(40)44-23-15-11-21(12-16-23)19-43-38(41)42/h4-7,9-16,18H,2-3,8,17,19H2,1H3 |
| InChIKey | BJYMQGLVKULALA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 157.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.03 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|