C26H30ClN7O5 — CID 143266571
[4-[amino-[(Z)-[amino-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]methylidene]amino]amino]-4-oxobutyl] nitrate (PubChem CID 143266571) has the molecular formula C26H30ClN7O5 and a molecular weight of 556.02 g/mol. Its IUPAC name is [4-[amino-[(Z)-[amino-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]methylidene]amino]amino]-4-oxobutyl] nitrate.
| Compound Name | [4-[amino-[(Z)-[amino-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]methylidene]amino]amino]-4-oxobutyl] nitrate |
|---|---|
| PubChem CID | 143266571 |
| Molecular Formula | C26H30ClN7O5 |
| Molecular Weight | 556.02 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | [4-[amino-[(Z)-[amino-[2-[4-[(2-butyl-4-chloro-5-formylimidazol-1-yl)methyl]phenyl]phenyl]methylidene]amino]amino]-4-oxobutyl] nitrate |
| SMILES | CCCCc1nc(Cl)c(C=O)n1Cc1ccc(-c2ccccc2/C(N)=N/N(N)C(=O)CCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H30ClN7O5/c1-2-3-9-23-30-25(27)22(17-35)32(23)16-18-11-13-19(14-12-18)20-7-4-5-8-21(20)26(28)31-33(29)24(36)10-6-15-39-34(37)38/h4-5,7-8,11-14,17H,2-3,6,9-10,15-16,29H2,1H3,(H2,28,31) |
| InChIKey | RQRCNEZEMGIRIC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 171.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.02 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|