C30H29Cl2N3O2 — CID 23661550
methyl 2-[4-[[2-butyl-4-chloro-5-[(4-chlorophenyl)methyliminomethyl]imidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 23661550) has the molecular formula C30H29Cl2N3O2 and a molecular weight of 534.49 g/mol. Its IUPAC name is methyl 2-[4-[[2-butyl-4-chloro-5-[(4-chlorophenyl)methyliminomethyl]imidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[[2-butyl-4-chloro-5-[(4-chlorophenyl)methyliminomethyl]imidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 23661550 |
| Molecular Formula | C30H29Cl2N3O2 |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | methyl 2-[4-[[2-butyl-4-chloro-5-[(4-chlorophenyl)methyliminomethyl]imidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCc1nc(Cl)c(/C=N/Cc2ccc(Cl)cc2)n1Cc1ccc(-c2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C30H29Cl2N3O2/c1-3-4-9-28-34-29(32)27(19-33-18-21-12-16-24(31)17-13-21)35(28)20-22-10-14-23(15-11-22)25-7-5-6-8-26(25)30(36)37-2/h5-8,10-17,19H,3-4,9,18,20H2,1-2H3/b33-19+ |
| InChIKey | OAPQEUILFRAIHC-HNSNBQBZSA-N |
| XLogP | 7.65 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|