C27H33ClN2O5 — CID 15698088
methyl 2-[4-[[2-butyl-4-chloro-5-(2-methoxyethoxymethoxymethyl)imidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 15698088) has the molecular formula C27H33ClN2O5 and a molecular weight of 501.02 g/mol. Its IUPAC name is methyl 2-[4-[[2-butyl-4-chloro-5-(2-methoxyethoxymethoxymethyl)imidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[[2-butyl-4-chloro-5-(2-methoxyethoxymethoxymethyl)imidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 15698088 |
| Molecular Formula | C27H33ClN2O5 |
| Molecular Weight | 501.02 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | methyl 2-[4-[[2-butyl-4-chloro-5-(2-methoxyethoxymethoxymethyl)imidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCc1nc(Cl)c(COCOCCOC)n1Cc1ccc(-c2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C27H33ClN2O5/c1-4-5-10-25-29-26(28)24(18-35-19-34-16-15-32-2)30(25)17-20-11-13-21(14-12-20)22-8-6-7-9-23(22)27(31)33-3/h6-9,11-14H,4-5,10,15-19H2,1-3H3 |
| InChIKey | OXINGWAPUCLVLL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.02 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|