C25H24ClN3O3 — CID 19815339
methyl 2-[4-[[2-butyl-4-chloro-5-(cyanomethyl)imidazol-1-yl]methyl]benzoyl]benzoate (PubChem CID 19815339) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is methyl 2-[4-[[2-butyl-4-chloro-5-(cyanomethyl)imidazol-1-yl]methyl]benzoyl]benzoate.
| Compound Name | methyl 2-[4-[[2-butyl-4-chloro-5-(cyanomethyl)imidazol-1-yl]methyl]benzoyl]benzoate |
|---|---|
| PubChem CID | 19815339 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | methyl 2-[4-[[2-butyl-4-chloro-5-(cyanomethyl)imidazol-1-yl]methyl]benzoyl]benzoate |
| SMILES | CCCCc1nc(Cl)c(CC#N)n1Cc1ccc(C(=O)c2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C25H24ClN3O3/c1-3-4-9-22-28-24(26)21(14-15-27)29(22)16-17-10-12-18(13-11-17)23(30)19-7-5-6-8-20(19)25(31)32-2/h5-8,10-13H,3-4,9,14,16H2,1-2H3 |
| InChIKey | KHKKWUAAYXZQLG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |