C37H45ClN4O4 — CID 139751042
methyl 2-[4-[[2-butyl-4-chloro-5-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxymethyl]imidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 139751042) has the molecular formula C37H45ClN4O4 and a molecular weight of 645.24 g/mol. Its IUPAC name is methyl 2-[4-[[2-butyl-4-chloro-5-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxymethyl]imidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | methyl 2-[4-[[2-butyl-4-chloro-5-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxymethyl]imidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 139751042 |
| Molecular Formula | C37H45ClN4O4 |
| Molecular Weight | 645.24 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | methyl 2-[4-[[2-butyl-4-chloro-5-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxymethyl]imidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCc1nc(Cl)c(COCCCN2CCN(c3ccccc3OC)CC2)n1Cc1ccc(-c2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C37H45ClN4O4/c1-4-5-15-35-39-36(38)33(27-46-25-10-20-40-21-23-41(24-22-40)32-13-8-9-14-34(32)44-2)42(35)26-28-16-18-29(19-17-28)30-11-6-7-12-31(30)37(43)45-3/h6-9,11-14,16-19H,4-5,10,15,20-27H2,1-3H3 |
| InChIKey | HJIXKZGCOCOCJK-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 69.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.24 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|