C30H34N2O3 — CID 15069223
tert-butyl 2-[4-[(2-butyl-7-methoxybenzimidazol-1-yl)methyl]phenyl]benzoate (PubChem CID 15069223) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is tert-butyl 2-[4-[(2-butyl-7-methoxybenzimidazol-1-yl)methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[(2-butyl-7-methoxybenzimidazol-1-yl)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 15069223 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | tert-butyl 2-[4-[(2-butyl-7-methoxybenzimidazol-1-yl)methyl]phenyl]benzoate |
| SMILES | CCCCc1nc2cccc(OC)c2n1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H34N2O3/c1-6-7-15-27-31-25-13-10-14-26(34-5)28(25)32(27)20-21-16-18-22(19-17-21)23-11-8-9-12-24(23)29(33)35-30(2,3)4/h8-14,16-19H,6-7,15,20H2,1-5H3 |
| InChIKey | SAJDYWFOLGPNPR-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |