C26H26N2O3 — CID 15069142
tert-butyl 2-[4-[[2-(hydroxymethyl)benzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 15069142) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is tert-butyl 2-[4-[[2-(hydroxymethyl)benzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[2-(hydroxymethyl)benzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 15069142 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | tert-butyl 2-[4-[[2-(hydroxymethyl)benzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccccc1-c1ccc(Cn2c(CO)nc3ccccc32)cc1 |
| InChI | InChI=1S/C26H26N2O3/c1-26(2,3)31-25(30)21-9-5-4-8-20(21)19-14-12-18(13-15-19)16-28-23-11-7-6-10-22(23)27-24(28)17-29/h4-15,29H,16-17H2,1-3H3 |
| InChIKey | XINNBRUJIKAWDD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |