C29H32N2O3S — CID 67756197
tert-butyl [2-[4-[[2-(propylsulfanylmethyl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate (PubChem CID 67756197) has the molecular formula C29H32N2O3S and a molecular weight of 488.65 g/mol. Its IUPAC name is tert-butyl [2-[4-[[2-(propylsulfanylmethyl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[4-[[2-(propylsulfanylmethyl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 67756197 |
| Molecular Formula | C29H32N2O3S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | tert-butyl [2-[4-[[2-(propylsulfanylmethyl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
| SMILES | CCCSCc1nc2ccccc2n1Cc1ccc(-c2ccccc2OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H32N2O3S/c1-5-18-35-20-27-30-24-11-7-8-12-25(24)31(27)19-21-14-16-22(17-15-21)23-10-6-9-13-26(23)33-28(32)34-29(2,3)4/h6-17H,5,18-20H2,1-4H3 |
| InChIKey | UCBGPEWBCCAYHK-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|