C32H38N2O5 — CID 67756829
tert-butyl [2-[4-[[5,6-dimethoxy-2-(3-methylbutyl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate (PubChem CID 67756829) has the molecular formula C32H38N2O5 and a molecular weight of 530.67 g/mol. Its IUPAC name is tert-butyl [2-[4-[[5,6-dimethoxy-2-(3-methylbutyl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[4-[[5,6-dimethoxy-2-(3-methylbutyl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 67756829 |
| Molecular Formula | C32H38N2O5 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | tert-butyl [2-[4-[[5,6-dimethoxy-2-(3-methylbutyl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
| SMILES | COc1cc2nc(CCC(C)C)n(Cc3ccc(-c4ccccc4OC(=O)OC(C)(C)C)cc3)c2cc1OC |
| InChI | InChI=1S/C32H38N2O5/c1-21(2)12-17-30-33-25-18-28(36-6)29(37-7)19-26(25)34(30)20-22-13-15-23(16-14-22)24-10-8-9-11-27(24)38-31(35)39-32(3,4)5/h8-11,13-16,18-19,21H,12,17,20H2,1-7H3 |
| InChIKey | WJUNUSGZRDZSBA-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|