C37H43N3O4 — CID 67691849
tert-butyl [2-[4-[[2-butyl-5-(3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate (PubChem CID 67691849) has the molecular formula C37H43N3O4 and a molecular weight of 593.77 g/mol. Its IUPAC name is tert-butyl [2-[4-[[2-butyl-5-(3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[4-[[2-butyl-5-(3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 67691849 |
| Molecular Formula | C37H43N3O4 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.33 |
| IUPAC Name | tert-butyl [2-[4-[[2-butyl-5-(3-oxo-3a,4,5,6,7,7a-hexahydro-1H-isoindol-2-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
| SMILES | CCCCc1nc2cc(N3CC4CCCCC4C3=O)ccc2n1Cc1ccc(-c2ccccc2OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C37H43N3O4/c1-5-6-15-34-38-31-22-28(39-24-27-11-7-8-13-30(27)35(39)41)20-21-32(31)40(34)23-25-16-18-26(19-17-25)29-12-9-10-14-33(29)43-36(42)44-37(2,3)4/h9-10,12,14,16-22,27,30H,5-8,11,13,15,23-24H2,1-4H3 |
| InChIKey | HJKIKMVETVMHLA-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|