C37H36N4O5 — CID 67909999
tert-butyl [2-[4-[[2-butyl-6-(1,3-dioxoisoindol-2-yl)-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] carbonate (PubChem CID 67909999) has the molecular formula C37H36N4O5 and a molecular weight of 616.72 g/mol. Its IUPAC name is tert-butyl [2-[4-[[2-butyl-6-(1,3-dioxoisoindol-2-yl)-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[4-[[2-butyl-6-(1,3-dioxoisoindol-2-yl)-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 67909999 |
| Molecular Formula | C37H36N4O5 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.27 |
| IUPAC Name | tert-butyl [2-[4-[[2-butyl-6-(1,3-dioxoisoindol-2-yl)-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] carbonate |
| SMILES | CCCCc1nc2cc(N3C(=O)c4ccccc4C3=O)c(C)nc2n1Cc1ccc(-c2ccccc2OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C37H36N4O5/c1-6-7-16-32-39-29-21-30(41-34(42)27-13-8-9-14-28(27)35(41)43)23(2)38-33(29)40(32)22-24-17-19-25(20-18-24)26-12-10-11-15-31(26)45-36(44)46-37(3,4)5/h8-15,17-21H,6-7,16,22H2,1-5H3 |
| InChIKey | OROMMKLXEWSOEX-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|