C38H49N3O4 — CID 67757411
[2-[4-[[6-[butanoyl(pentyl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] tert-butyl carbonate (PubChem CID 67757411) has the molecular formula C38H49N3O4 and a molecular weight of 611.83 g/mol. Its IUPAC name is [2-[4-[[6-[butanoyl(pentyl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] tert-butyl carbonate.
| Compound Name | [2-[4-[[6-[butanoyl(pentyl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 67757411 |
| Molecular Formula | C38H49N3O4 |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.37 |
| IUPAC Name | [2-[4-[[6-[butanoyl(pentyl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] tert-butyl carbonate |
| SMILES | CCCCCN(C(=O)CCC)c1ccc2nc(CCCC)n(Cc3ccc(-c4ccccc4OC(=O)OC(C)(C)C)cc3)c2c1 |
| InChI | InChI=1S/C38H49N3O4/c1-7-10-14-25-40(36(42)15-9-3)30-23-24-32-33(26-30)41(35(39-32)18-11-8-2)27-28-19-21-29(22-20-28)31-16-12-13-17-34(31)44-37(43)45-38(4,5)6/h12-13,16-17,19-24,26H,7-11,14-15,18,25,27H2,1-6H3 |
| InChIKey | GZLSMPIHEKJXGP-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|