C35H41F3N4O6 — CID 67757265
[2-[4-[[2-butyl-6-[dimethylcarbamoyl(pentyl)amino]benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate;2,2,2-trifluoroacetic acid (PubChem CID 67757265) has the molecular formula C35H41F3N4O6 and a molecular weight of 670.73 g/mol. Its IUPAC name is [2-[4-[[2-butyl-6-[dimethylcarbamoyl(pentyl)amino]benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate;2,2,2-trifluoroacetic acid.
| Compound Name | [2-[4-[[2-butyl-6-[dimethylcarbamoyl(pentyl)amino]benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67757265 |
| Molecular Formula | C35H41F3N4O6 |
| Molecular Weight | 670.73 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | [2-[4-[[2-butyl-6-[dimethylcarbamoyl(pentyl)amino]benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCN(C(=O)N(C)C)c1ccc2nc(CCCC)n(Cc3ccc(-c4ccccc4OC(=O)O)cc3)c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H40N4O4.C2HF3O2/c1-5-7-11-21-36(32(38)35(3)4)26-19-20-28-29(22-26)37(31(34-28)14-8-6-2)23-24-15-17-25(18-16-24)27-12-9-10-13-30(27)41-33(39)40;3-2(4,5)1(6)7/h9-10,12-13,15-20,22H,5-8,11,14,21,23H2,1-4H3,(H,39,40);(H,6,7) |
| InChIKey | RMSARZAFNALSOI-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.73 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|