C29H26N4O4 — CID 67691526
[2-[4-[[2-butyl-6-(6-oxo-1H-pyridazin-3-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 67691526) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is [2-[4-[[2-butyl-6-(6-oxo-1H-pyridazin-3-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-[[2-butyl-6-(6-oxo-1H-pyridazin-3-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67691526 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | [2-[4-[[2-butyl-6-(6-oxo-1H-pyridazin-3-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCCc1nc2ccc(-c3ccc(=O)[nH]n3)cc2n1Cc1ccc(-c2ccccc2OC(=O)O)cc1 |
| InChI | InChI=1S/C29H26N4O4/c1-2-3-8-27-30-24-14-13-21(23-15-16-28(34)32-31-23)17-25(24)33(27)18-19-9-11-20(12-10-19)22-6-4-5-7-26(22)37-29(35)36/h4-7,9-17H,2-3,8,18H2,1H3,(H,32,34)(H,35,36) |
| InChIKey | XZVYZAUHCFZQIY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|