C35H35N3O4 — CID 67692049
[2-[4-[[6-[benzoyl(propan-2-yl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 67692049) has the molecular formula C35H35N3O4 and a molecular weight of 561.68 g/mol. Its IUPAC name is [2-[4-[[6-[benzoyl(propan-2-yl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-[[6-[benzoyl(propan-2-yl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67692049 |
| Molecular Formula | C35H35N3O4 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | [2-[4-[[6-[benzoyl(propan-2-yl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCCc1nc2ccc(N(C(=O)c3ccccc3)C(C)C)cc2n1Cc1ccc(-c2ccccc2OC(=O)O)cc1 |
| InChI | InChI=1S/C35H35N3O4/c1-4-5-15-33-36-30-21-20-28(38(24(2)3)34(39)27-11-7-6-8-12-27)22-31(30)37(33)23-25-16-18-26(19-17-25)29-13-9-10-14-32(29)42-35(40)41/h6-14,16-22,24H,4-5,15,23H2,1-3H3,(H,40,41) |
| InChIKey | OQYPLSAVIQOJNU-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|