C30H33N3O4 — CID 70050699
[2-[4-[[2-butyl-4-methyl-6-(2-methylpropanoylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 70050699) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is [2-[4-[[2-butyl-4-methyl-6-(2-methylpropanoylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-[[2-butyl-4-methyl-6-(2-methylpropanoylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 70050699 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | [2-[4-[[2-butyl-4-methyl-6-(2-methylpropanoylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCCc1nc2c(C)cc(NC(=O)C(C)C)cc2n1Cc1ccc(-c2ccccc2OC(=O)O)cc1 |
| InChI | InChI=1S/C30H33N3O4/c1-5-6-11-27-32-28-20(4)16-23(31-29(34)19(2)3)17-25(28)33(27)18-21-12-14-22(15-13-21)24-9-7-8-10-26(24)37-30(35)36/h7-10,12-17,19H,5-6,11,18H2,1-4H3,(H,31,34)(H,35,36) |
| InChIKey | FUCQGDWAMANOCZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|