C25H24N2O4 — CID 67756345
[2-[4-[(2-butyl-5-hydroxybenzimidazol-1-yl)methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 67756345) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is [2-[4-[(2-butyl-5-hydroxybenzimidazol-1-yl)methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-[(2-butyl-5-hydroxybenzimidazol-1-yl)methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67756345 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [2-[4-[(2-butyl-5-hydroxybenzimidazol-1-yl)methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCCc1nc2cc(O)ccc2n1Cc1ccc(-c2ccccc2OC(=O)O)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-2-3-8-24-26-21-15-19(28)13-14-22(21)27(24)16-17-9-11-18(12-10-17)20-6-4-5-7-23(20)31-25(29)30/h4-7,9-15,28H,2-3,8,16H2,1H3,(H,29,30) |
| InChIKey | JYEFIPKRGOTFAX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|