C29H32N2O3 — CID 67756422
tert-butyl [2-[4-[(2-butylbenzimidazol-1-yl)methyl]phenyl]phenyl] carbonate (PubChem CID 67756422) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is tert-butyl [2-[4-[(2-butylbenzimidazol-1-yl)methyl]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[4-[(2-butylbenzimidazol-1-yl)methyl]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 67756422 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | tert-butyl [2-[4-[(2-butylbenzimidazol-1-yl)methyl]phenyl]phenyl] carbonate |
| SMILES | CCCCc1nc2ccccc2n1Cc1ccc(-c2ccccc2OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H32N2O3/c1-5-6-15-27-30-24-12-8-9-13-25(24)31(27)20-21-16-18-22(19-17-21)23-11-7-10-14-26(23)33-28(32)34-29(2,3)4/h7-14,16-19H,5-6,15,20H2,1-4H3 |
| InChIKey | ZIKSBTUQDMFHBI-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|