C33H40N4O4 — CID 67910181
tert-butyl [2-[4-[[2-butyl-5-(pentanoylamino)imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] carbonate (PubChem CID 67910181) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is tert-butyl [2-[4-[[2-butyl-5-(pentanoylamino)imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[4-[[2-butyl-5-(pentanoylamino)imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 67910181 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | tert-butyl [2-[4-[[2-butyl-5-(pentanoylamino)imidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] carbonate |
| SMILES | CCCCC(=O)Nc1ccc2nc(CCCC)n(Cc3ccc(-c4ccccc4OC(=O)OC(C)(C)C)cc3)c2n1 |
| InChI | InChI=1S/C33H40N4O4/c1-6-8-14-29-34-26-20-21-28(35-30(38)15-9-7-2)36-31(26)37(29)22-23-16-18-24(19-17-23)25-12-10-11-13-27(25)40-32(39)41-33(3,4)5/h10-13,16-21H,6-9,14-15,22H2,1-5H3,(H,35,36,38) |
| InChIKey | IPYXGLJHMBSROP-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|