C33H40N4O4 — CID 67910008
[2-[4-[[6-(butanoylamino)-2-butyl-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] tert-butyl carbonate (PubChem CID 67910008) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is [2-[4-[[6-(butanoylamino)-2-butyl-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] tert-butyl carbonate.
| Compound Name | [2-[4-[[6-(butanoylamino)-2-butyl-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 67910008 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | [2-[4-[[6-(butanoylamino)-2-butyl-5-methylimidazo[4,5-b]pyridin-3-yl]methyl]phenyl]phenyl] tert-butyl carbonate |
| SMILES | CCCCc1nc2cc(NC(=O)CCC)c(C)nc2n1Cc1ccc(-c2ccccc2OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C33H40N4O4/c1-7-9-15-29-35-27-20-26(36-30(38)12-8-2)22(3)34-31(27)37(29)21-23-16-18-24(19-17-23)25-13-10-11-14-28(25)40-32(39)41-33(4,5)6/h10-11,13-14,16-20H,7-9,12,15,21H2,1-6H3,(H,36,38) |
| InChIKey | LDHLOLJHYXMOJE-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|