C35H41N3O4 — CID 67755933
tert-butyl [2-[4-[[2-butyl-6-(cyclopentanecarbonylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate (PubChem CID 67755933) has the molecular formula C35H41N3O4 and a molecular weight of 567.73 g/mol. Its IUPAC name is tert-butyl [2-[4-[[2-butyl-6-(cyclopentanecarbonylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[4-[[2-butyl-6-(cyclopentanecarbonylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 67755933 |
| Molecular Formula | C35H41N3O4 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | tert-butyl [2-[4-[[2-butyl-6-(cyclopentanecarbonylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
| SMILES | CCCCc1nc2ccc(NC(=O)C3CCCC3)cc2n1Cc1ccc(-c2ccccc2OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C35H41N3O4/c1-5-6-15-32-37-29-21-20-27(36-33(39)26-11-7-8-12-26)22-30(29)38(32)23-24-16-18-25(19-17-24)28-13-9-10-14-31(28)41-34(40)42-35(2,3)4/h9-10,13-14,16-22,26H,5-8,11-12,15,23H2,1-4H3,(H,36,39) |
| InChIKey | FKBRNAAKHAAYOZ-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|