C33H38N4O5 — CID 67757750
[2-[4-[[2-butyl-6-(oxan-2-ylcarbamoylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] ethyl carbonate (PubChem CID 67757750) has the molecular formula C33H38N4O5 and a molecular weight of 570.69 g/mol. Its IUPAC name is [2-[4-[[2-butyl-6-(oxan-2-ylcarbamoylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] ethyl carbonate.
| Compound Name | [2-[4-[[2-butyl-6-(oxan-2-ylcarbamoylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 67757750 |
| Molecular Formula | C33H38N4O5 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | [2-[4-[[2-butyl-6-(oxan-2-ylcarbamoylamino)benzimidazol-1-yl]methyl]phenyl]phenyl] ethyl carbonate |
| SMILES | CCCCc1nc2ccc(NC(=O)NC3CCCCO3)cc2n1Cc1ccc(-c2ccccc2OC(=O)OCC)cc1 |
| InChI | InChI=1S/C33H38N4O5/c1-3-5-12-30-35-27-19-18-25(34-32(38)36-31-13-8-9-20-41-31)21-28(27)37(30)22-23-14-16-24(17-15-23)26-10-6-7-11-29(26)42-33(39)40-4-2/h6-7,10-11,14-19,21,31H,3-5,8-9,12-13,20,22H2,1-2H3,(H2,34,36,38) |
| InChIKey | CBQCQINWOVAJQX-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|