C40H48N4O3 — CID 15104339
tert-butyl 2-[4-[[6-(1-adamantylcarbamoylamino)-2-butylbenzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 15104339) has the molecular formula C40H48N4O3 and a molecular weight of 632.85 g/mol. Its IUPAC name is tert-butyl 2-[4-[[6-(1-adamantylcarbamoylamino)-2-butylbenzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[6-(1-adamantylcarbamoylamino)-2-butylbenzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 15104339 |
| Molecular Formula | C40H48N4O3 |
| Molecular Weight | 632.85 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | tert-butyl 2-[4-[[6-(1-adamantylcarbamoylamino)-2-butylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCc1nc2ccc(NC(=O)NC34CC5CC(CC(C5)C3)C4)cc2n1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C40H48N4O3/c1-5-6-11-36-42-34-17-16-31(41-38(46)43-40-22-27-18-28(23-40)20-29(19-27)24-40)21-35(34)44(36)25-26-12-14-30(15-13-26)32-9-7-8-10-33(32)37(45)47-39(2,3)4/h7-10,12-17,21,27-29H,5-6,11,18-20,22-25H2,1-4H3,(H2,41,43,46) |
| InChIKey | VJGUKBSZESZJHD-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.85 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |