C36H43N3O5 — CID 67572277
6-[[2-butyl-3-[[4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]phenyl]methyl]benzimidazole-5-carbonyl]amino]hexanoic acid (PubChem CID 67572277) has the molecular formula C36H43N3O5 and a molecular weight of 597.76 g/mol. Its IUPAC name is 6-[[2-butyl-3-[[4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]phenyl]methyl]benzimidazole-5-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[2-butyl-3-[[4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]phenyl]methyl]benzimidazole-5-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 67572277 |
| Molecular Formula | C36H43N3O5 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.32 |
| IUPAC Name | 6-[[2-butyl-3-[[4-[2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]phenyl]methyl]benzimidazole-5-carbonyl]amino]hexanoic acid |
| SMILES | CCCCc1nc2ccc(C(=O)NCCCCCC(=O)O)cc2n1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C36H43N3O5/c1-5-6-14-32-38-30-21-20-27(34(42)37-22-11-7-8-15-33(40)41)23-31(30)39(32)24-25-16-18-26(19-17-25)28-12-9-10-13-29(28)35(43)44-36(2,3)4/h9-10,12-13,16-21,23H,5-8,11,14-15,22,24H2,1-4H3,(H,37,42)(H,40,41) |
| InChIKey | VCNCZQMLCMNGFC-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|