C38H42N4O3 — CID 67572326
tert-butyl 2-[4-[[6-(2-anilinoethylcarbamoyl)-2-butylbenzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 67572326) has the molecular formula C38H42N4O3 and a molecular weight of 602.78 g/mol. Its IUPAC name is tert-butyl 2-[4-[[6-(2-anilinoethylcarbamoyl)-2-butylbenzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[6-(2-anilinoethylcarbamoyl)-2-butylbenzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 67572326 |
| Molecular Formula | C38H42N4O3 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | tert-butyl 2-[4-[[6-(2-anilinoethylcarbamoyl)-2-butylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCc1nc2ccc(C(=O)NCCNc3ccccc3)cc2n1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C38H42N4O3/c1-5-6-16-35-41-33-22-21-29(36(43)40-24-23-39-30-12-8-7-9-13-30)25-34(33)42(35)26-27-17-19-28(20-18-27)31-14-10-11-15-32(31)37(44)45-38(2,3)4/h7-15,17-22,25,39H,5-6,16,23-24,26H2,1-4H3,(H,40,43) |
| InChIKey | REPPUQQZUWBIRE-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|