C29H33N3O2 — CID 10389303
tert-butyl 2-[4-[(6-amino-2-butylbenzimidazol-1-yl)methyl]phenyl]benzoate (PubChem CID 10389303) has the molecular formula C29H33N3O2 and a molecular weight of 455.60 g/mol. Its IUPAC name is tert-butyl 2-[4-[(6-amino-2-butylbenzimidazol-1-yl)methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[(6-amino-2-butylbenzimidazol-1-yl)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 10389303 |
| Molecular Formula | C29H33N3O2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | tert-butyl 2-[4-[(6-amino-2-butylbenzimidazol-1-yl)methyl]phenyl]benzoate |
| SMILES | CCCCc1nc2ccc(N)cc2n1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H33N3O2/c1-5-6-11-27-31-25-17-16-22(30)18-26(25)32(27)19-20-12-14-21(15-13-20)23-9-7-8-10-24(23)28(33)34-29(2,3)4/h7-10,12-18H,5-6,11,19,30H2,1-4H3 |
| InChIKey | IRPIPOLLMTURMD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|