C34H35N3O4 — CID 151635163
tert-butyl 2-[4-[[6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 151635163) has the molecular formula C34H35N3O4 and a molecular weight of 549.67 g/mol. Its IUPAC name is tert-butyl 2-[4-[[6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 151635163 |
| Molecular Formula | C34H35N3O4 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | tert-butyl 2-[4-[[6-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCc1nc2ccc(N3C(=O)C(C)=C(C)C3=O)cc2n1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H35N3O4/c1-7-10-30-35-28-18-17-25(37-31(38)21(2)22(3)32(37)39)19-29(28)36(30)20-23-13-15-24(16-14-23)26-11-8-9-12-27(26)33(40)41-34(4,5)6/h8-9,11-19H,7,10,20H2,1-6H3 |
| InChIKey | QRIOQXQLEKGTHF-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|