C37H35N3O4 — CID 67732890
tert-butyl 2-[4-[[6-(1,3-dioxoisoindol-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 67732890) has the molecular formula C37H35N3O4 and a molecular weight of 585.70 g/mol. Its IUPAC name is tert-butyl 2-[4-[[6-(1,3-dioxoisoindol-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[6-(1,3-dioxoisoindol-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 67732890 |
| Molecular Formula | C37H35N3O4 |
| Molecular Weight | 585.70 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | tert-butyl 2-[4-[[6-(1,3-dioxoisoindol-2-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCc1nc2c(C)cc(N3C(=O)c4ccccc4C3=O)cc2n1Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C37H35N3O4/c1-6-11-32-38-33-23(2)20-26(40-34(41)28-13-8-9-14-29(28)35(40)42)21-31(33)39(32)22-24-16-18-25(19-17-24)27-12-7-10-15-30(27)36(43)44-37(3,4)5/h7-10,12-21H,6,11,22H2,1-5H3 |
| InChIKey | AFULSNZTBYJGNT-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.70 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|