C25H23ClN2O3 — CID 67755920
tert-butyl [2-[4-[(2-chlorobenzimidazol-1-yl)methyl]phenyl]phenyl] carbonate (PubChem CID 67755920) has the molecular formula C25H23ClN2O3 and a molecular weight of 434.92 g/mol. Its IUPAC name is tert-butyl [2-[4-[(2-chlorobenzimidazol-1-yl)methyl]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[4-[(2-chlorobenzimidazol-1-yl)methyl]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 67755920 |
| Molecular Formula | C25H23ClN2O3 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | tert-butyl [2-[4-[(2-chlorobenzimidazol-1-yl)methyl]phenyl]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccccc1-c1ccc(Cn2c(Cl)nc3ccccc32)cc1 |
| InChI | InChI=1S/C25H23ClN2O3/c1-25(2,3)31-24(29)30-22-11-7-4-8-19(22)18-14-12-17(13-15-18)16-28-21-10-6-5-9-20(21)27-23(28)26/h4-15H,16H2,1-3H3 |
| InChIKey | RIDJZFURLQFRJA-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|