C29H31N3O3 — CID 67755867
[2-[4-[[6-amino-2-[(E)-but-1-enyl]benzimidazol-1-yl]methyl]phenyl]phenyl] tert-butyl carbonate (PubChem CID 67755867) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is [2-[4-[[6-amino-2-[(E)-but-1-enyl]benzimidazol-1-yl]methyl]phenyl]phenyl] tert-butyl carbonate.
| Compound Name | [2-[4-[[6-amino-2-[(E)-but-1-enyl]benzimidazol-1-yl]methyl]phenyl]phenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 67755867 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | [2-[4-[[6-amino-2-[(E)-but-1-enyl]benzimidazol-1-yl]methyl]phenyl]phenyl] tert-butyl carbonate |
| SMILES | CC/C=C/c1nc2ccc(N)cc2n1Cc1ccc(-c2ccccc2OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H31N3O3/c1-5-6-11-27-31-24-17-16-22(30)18-25(24)32(27)19-20-12-14-21(15-13-20)23-9-7-8-10-26(23)34-28(33)35-29(2,3)4/h6-18H,5,19,30H2,1-4H3/b11-6+ |
| InChIKey | FSONCMPGKLWVFK-IZZDOVSWSA-N |
| XLogP | 7.07 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|