C34H40N2O5 — CID 67755969
tert-butyl [2-[4-[[2-(cyclohexylmethyl)-5,6-dimethoxybenzimidazol-1-yl]methyl]phenyl]phenyl] carbonate (PubChem CID 67755969) has the molecular formula C34H40N2O5 and a molecular weight of 556.70 g/mol. Its IUPAC name is tert-butyl [2-[4-[[2-(cyclohexylmethyl)-5,6-dimethoxybenzimidazol-1-yl]methyl]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[4-[[2-(cyclohexylmethyl)-5,6-dimethoxybenzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 67755969 |
| Molecular Formula | C34H40N2O5 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | tert-butyl [2-[4-[[2-(cyclohexylmethyl)-5,6-dimethoxybenzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
| SMILES | COc1cc2nc(CC3CCCCC3)n(Cc3ccc(-c4ccccc4OC(=O)OC(C)(C)C)cc3)c2cc1OC |
| InChI | InChI=1S/C34H40N2O5/c1-34(2,3)41-33(37)40-29-14-10-9-13-26(29)25-17-15-24(16-18-25)22-36-28-21-31(39-5)30(38-4)20-27(28)35-32(36)19-23-11-7-6-8-12-23/h9-10,13-18,20-21,23H,6-8,11-12,19,22H2,1-5H3 |
| InChIKey | KSVGIHGTLRWGLS-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|