C30H32N2O5 — CID 67756732
[2-[4-[[2-(cyclohexylmethyl)-5,6-dimethoxybenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 67756732) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is [2-[4-[[2-(cyclohexylmethyl)-5,6-dimethoxybenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-[[2-(cyclohexylmethyl)-5,6-dimethoxybenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67756732 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | [2-[4-[[2-(cyclohexylmethyl)-5,6-dimethoxybenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | COc1cc2nc(CC3CCCCC3)n(Cc3ccc(-c4ccccc4OC(=O)O)cc3)c2cc1OC |
| InChI | InChI=1S/C30H32N2O5/c1-35-27-17-24-25(18-28(27)36-2)32(29(31-24)16-20-8-4-3-5-9-20)19-21-12-14-22(15-13-21)23-10-6-7-11-26(23)37-30(33)34/h6-7,10-15,17-18,20H,3-5,8-9,16,19H2,1-2H3,(H,33,34) |
| InChIKey | HESNXDDFELTXIK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|