C46H54F2N6O8 — CID 70391591
bis(1-[(4-fluorophenyl)methyl]-5,6-dimethoxy-2-(piperidin-4-ylmethyl)benzimidazole);oxalic acid (PubChem CID 70391591) has the molecular formula C46H54F2N6O8 and a molecular weight of 856.97 g/mol. Its IUPAC name is bis(1-[(4-fluorophenyl)methyl]-5,6-dimethoxy-2-(piperidin-4-ylmethyl)benzimidazole);oxalic acid.
| Compound Name | bis(1-[(4-fluorophenyl)methyl]-5,6-dimethoxy-2-(piperidin-4-ylmethyl)benzimidazole);oxalic acid |
|---|---|
| PubChem CID | 70391591 |
| Molecular Formula | C46H54F2N6O8 |
| Molecular Weight | 856.97 g/mol |
| Exact Mass | 856.40 |
| IUPAC Name | bis(1-[(4-fluorophenyl)methyl]-5,6-dimethoxy-2-(piperidin-4-ylmethyl)benzimidazole);oxalic acid |
| SMILES | COc1cc2nc(CC3CCNCC3)n(Cc3ccc(F)cc3)c2cc1OC.COc1cc2nc(CC3CCNCC3)n(Cc3ccc(F)cc3)c2cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/2C22H26FN3O2.C2H2O4/c2*1-27-20-12-18-19(13-21(20)28-2)26(14-16-3-5-17(23)6-4-16)22(25-18)11-15-7-9-24-10-8-15;3-1(4)2(5)6/h2*3-6,12-13,15,24H,7-11,14H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | WHHPZLZCVKQGNU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.97 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|