C25H28FN3O4 — CID 162331537
1-[(4-fluorophenyl)methyl]-2-[(1-prop-2-enylpiperidin-4-yl)methyl]benzimidazole;oxalic acid (PubChem CID 162331537) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-2-[(1-prop-2-enylpiperidin-4-yl)methyl]benzimidazole;oxalic acid.
| Compound Name | 1-[(4-fluorophenyl)methyl]-2-[(1-prop-2-enylpiperidin-4-yl)methyl]benzimidazole;oxalic acid |
|---|---|
| PubChem CID | 162331537 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-2-[(1-prop-2-enylpiperidin-4-yl)methyl]benzimidazole;oxalic acid |
| SMILES | C=CCN1CCC(Cc2nc3ccccc3n2Cc2ccc(F)cc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H26FN3.C2H2O4/c1-2-13-26-14-11-18(12-15-26)16-23-25-21-5-3-4-6-22(21)27(23)17-19-7-9-20(24)10-8-19;3-1(4)2(5)6/h2-10,18H,1,11-17H2;(H,3,4)(H,5,6) |
| InChIKey | PZEXVDOBQZSFSJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|