C62H68F2N6O8 — CID 173396798
but-2-enedioic acid;bis(1-[(4-fluorophenyl)methyl]-2-[[1-[2-(2-methoxyphenyl)ethyl]piperidin-4-yl]methyl]benzimidazol-5-ol) (PubChem CID 173396798) has the molecular formula C62H68F2N6O8 and a molecular weight of 1063.26 g/mol. Its IUPAC name is but-2-enedioic acid;bis(1-[(4-fluorophenyl)methyl]-2-[[1-[2-(2-methoxyphenyl)ethyl]piperidin-4-yl]methyl]benzimidazol-5-ol).
| Compound Name | but-2-enedioic acid;bis(1-[(4-fluorophenyl)methyl]-2-[[1-[2-(2-methoxyphenyl)ethyl]piperidin-4-yl]methyl]benzimidazol-5-ol) |
|---|---|
| PubChem CID | 173396798 |
| Molecular Formula | C62H68F2N6O8 |
| Molecular Weight | 1063.26 g/mol |
| Exact Mass | 1062.51 |
| IUPAC Name | but-2-enedioic acid;bis(1-[(4-fluorophenyl)methyl]-2-[[1-[2-(2-methoxyphenyl)ethyl]piperidin-4-yl]methyl]benzimidazol-5-ol) |
| SMILES | COc1ccccc1CCN1CCC(Cc2nc3cc(O)ccc3n2Cc2ccc(F)cc2)CC1.COc1ccccc1CCN1CCC(Cc2nc3cc(O)ccc3n2Cc2ccc(F)cc2)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/2C29H32FN3O2.C4H4O4/c2*1-35-28-5-3-2-4-23(28)14-17-32-15-12-21(13-16-32)18-29-31-26-19-25(34)10-11-27(26)33(29)20-22-6-8-24(30)9-7-22;5-3(6)1-2-4(7)8/h2*2-11,19,21,34H,12-18,20H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | FFLLJTRJCJXQMZ-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 175.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.26 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|