C32H32N4O5 — CID 67910613
[2-[4-[[6-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-5-methyl-2-propylimidazo[4,5-b]pyridin-1-yl]methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 67910613) has the molecular formula C32H32N4O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is [2-[4-[[6-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-5-methyl-2-propylimidazo[4,5-b]pyridin-1-yl]methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-[[6-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-5-methyl-2-propylimidazo[4,5-b]pyridin-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67910613 |
| Molecular Formula | C32H32N4O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | [2-[4-[[6-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-5-methyl-2-propylimidazo[4,5-b]pyridin-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCc1nc2nc(C)c(N3C(=O)[C@H]4CCCC[C@H]4C3=O)cc2n1Cc1ccc(-c2ccccc2OC(=O)O)cc1 |
| InChI | InChI=1S/C32H32N4O5/c1-3-8-28-34-29-26(17-25(19(2)33-29)36-30(37)23-10-4-5-11-24(23)31(36)38)35(28)18-20-13-15-21(16-14-20)22-9-6-7-12-27(22)41-32(39)40/h6-7,9,12-17,23-24H,3-5,8,10-11,18H2,1-2H3,(H,39,40)/t23-,24+ |
| InChIKey | CKRBRKKVTWVOIA-PSWAGMNNSA-N |
| XLogP | 6.14 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|