C30H28N4O5S — CID 67756460
[2-[4-[[2-butyl-6-(5,7-dioxo-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-6-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 67756460) has the molecular formula C30H28N4O5S and a molecular weight of 556.64 g/mol. Its IUPAC name is [2-[4-[[2-butyl-6-(5,7-dioxo-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-6-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-[[2-butyl-6-(5,7-dioxo-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-6-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67756460 |
| Molecular Formula | C30H28N4O5S |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | [2-[4-[[2-butyl-6-(5,7-dioxo-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazol-6-yl)benzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCCc1nc2ccc(N3C(=O)C4CSCN4C3=O)cc2n1Cc1ccc(-c2ccccc2OC(=O)O)cc1 |
| InChI | InChI=1S/C30H28N4O5S/c1-2-3-8-27-31-23-14-13-21(34-28(35)25-17-40-18-33(25)29(34)36)15-24(23)32(27)16-19-9-11-20(12-10-19)22-6-4-5-7-26(22)39-30(37)38/h4-7,9-15,25H,2-3,8,16-18H2,1H3,(H,37,38) |
| InChIKey | OTSVMEYBQQYTCM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|