C36H39N3O5S — CID 67691506
[2-[4-[[6-[benzenesulfonyl(pentyl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 67691506) has the molecular formula C36H39N3O5S and a molecular weight of 625.79 g/mol. Its IUPAC name is [2-[4-[[6-[benzenesulfonyl(pentyl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-[[6-[benzenesulfonyl(pentyl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67691506 |
| Molecular Formula | C36H39N3O5S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | [2-[4-[[6-[benzenesulfonyl(pentyl)amino]-2-butylbenzimidazol-1-yl]methyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CCCCCN(c1ccc2nc(CCCC)n(Cc3ccc(-c4ccccc4OC(=O)O)cc3)c2c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C36H39N3O5S/c1-3-5-12-24-39(45(42,43)30-13-8-7-9-14-30)29-22-23-32-33(25-29)38(35(37-32)17-6-4-2)26-27-18-20-28(21-19-27)31-15-10-11-16-34(31)44-36(40)41/h7-11,13-16,18-23,25H,3-6,12,17,24,26H2,1-2H3,(H,40,41) |
| InChIKey | NEPIGQHIWQXREL-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|