C41H49N3O5S — CID 15661922
tert-butyl 2-[4-[[2-butyl-6-[(4-methoxyphenyl)sulfonyl-pentylamino]benzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 15661922) has the molecular formula C41H49N3O5S and a molecular weight of 695.93 g/mol. Its IUPAC name is tert-butyl 2-[4-[[2-butyl-6-[(4-methoxyphenyl)sulfonyl-pentylamino]benzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[2-butyl-6-[(4-methoxyphenyl)sulfonyl-pentylamino]benzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 15661922 |
| Molecular Formula | C41H49N3O5S |
| Molecular Weight | 695.93 g/mol |
| Exact Mass | 695.34 |
| IUPAC Name | tert-butyl 2-[4-[[2-butyl-6-[(4-methoxyphenyl)sulfonyl-pentylamino]benzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCCCCN(c1ccc2nc(CCCC)n(Cc3ccc(-c4ccccc4C(=O)OC(C)(C)C)cc3)c2c1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C41H49N3O5S/c1-7-9-13-27-44(50(46,47)34-24-22-33(48-6)23-25-34)32-21-26-37-38(28-32)43(39(42-37)16-10-8-2)29-30-17-19-31(20-18-30)35-14-11-12-15-36(35)40(45)49-41(3,4)5/h11-12,14-15,17-26,28H,7-10,13,16,27,29H2,1-6H3 |
| InChIKey | CJGVYSKVCDOLMK-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.93 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|