C26H27N3O3 — CID 67845208
[2-[4-[(6-amino-4-methyl-2-propylbenzimidazol-1-yl)methyl]phenyl]phenyl] methyl carbonate (PubChem CID 67845208) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is [2-[4-[(6-amino-4-methyl-2-propylbenzimidazol-1-yl)methyl]phenyl]phenyl] methyl carbonate.
| Compound Name | [2-[4-[(6-amino-4-methyl-2-propylbenzimidazol-1-yl)methyl]phenyl]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 67845208 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [2-[4-[(6-amino-4-methyl-2-propylbenzimidazol-1-yl)methyl]phenyl]phenyl] methyl carbonate |
| SMILES | CCCc1nc2c(C)cc(N)cc2n1Cc1ccc(-c2ccccc2OC(=O)OC)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-4-7-24-28-25-17(2)14-20(27)15-22(25)29(24)16-18-10-12-19(13-11-18)21-8-5-6-9-23(21)32-26(30)31-3/h5-6,8-15H,4,7,16,27H2,1-3H3 |
| InChIKey | JXSZAPBDXDQSNA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|