C39H46N4O3 — CID 67758084
tert-butyl [2-[4-[[6-(1-cycloheptylimidazol-4-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]phenyl] carbonate (PubChem CID 67758084) has the molecular formula C39H46N4O3 and a molecular weight of 618.82 g/mol. Its IUPAC name is tert-butyl [2-[4-[[6-(1-cycloheptylimidazol-4-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]phenyl] carbonate.
| Compound Name | tert-butyl [2-[4-[[6-(1-cycloheptylimidazol-4-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
|---|---|
| PubChem CID | 67758084 |
| Molecular Formula | C39H46N4O3 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | tert-butyl [2-[4-[[6-(1-cycloheptylimidazol-4-yl)-4-methyl-2-propylbenzimidazol-1-yl]methyl]phenyl]phenyl] carbonate |
| SMILES | CCCc1nc2c(C)cc(-c3cn(C4CCCCCC4)cn3)cc2n1Cc1ccc(-c2ccccc2OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C39H46N4O3/c1-6-13-36-41-37-27(2)22-30(33-25-42(26-40-33)31-14-9-7-8-10-15-31)23-34(37)43(36)24-28-18-20-29(21-19-28)32-16-11-12-17-35(32)45-38(44)46-39(3,4)5/h11-12,16-23,25-26,31H,6-10,13-15,24H2,1-5H3 |
| InChIKey | ZSRCYJSSWIIIGU-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 71.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|