C25H24N2O2S — CID 15069266
2-[4-[[2-(propylsulfanylmethyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 15069266) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is 2-[4-[[2-(propylsulfanylmethyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2-(propylsulfanylmethyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 15069266 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[4-[[2-(propylsulfanylmethyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCSCc1nc2ccccc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C25H24N2O2S/c1-2-15-30-17-24-26-22-9-5-6-10-23(22)27(24)16-18-11-13-19(14-12-18)20-7-3-4-8-21(20)25(28)29/h3-14H,2,15-17H2,1H3,(H,28,29) |
| InChIKey | XWEWIFSCTALIPX-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|