C39H30N2O5 — CID 19102920
2-[4-[(5,7-dibenzoyl-6-oxo-2-propylcyclohepta[d]imidazol-3-yl)methyl]phenyl]benzoic acid (PubChem CID 19102920) has the molecular formula C39H30N2O5 and a molecular weight of 606.68 g/mol. Its IUPAC name is 2-[4-[(5,7-dibenzoyl-6-oxo-2-propylcyclohepta[d]imidazol-3-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(5,7-dibenzoyl-6-oxo-2-propylcyclohepta[d]imidazol-3-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19102920 |
| Molecular Formula | C39H30N2O5 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.22 |
| IUPAC Name | 2-[4-[(5,7-dibenzoyl-6-oxo-2-propylcyclohepta[d]imidazol-3-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCc1nc2cc(C(=O)c3ccccc3)c(=O)c(C(=O)c3ccccc3)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C39H30N2O5/c1-2-11-35-40-33-22-31(36(42)27-12-5-3-6-13-27)38(44)32(37(43)28-14-7-4-8-15-28)23-34(33)41(35)24-25-18-20-26(21-19-25)29-16-9-10-17-30(29)39(45)46/h3-10,12-23H,2,11,24H2,1H3,(H,45,46) |
| InChIKey | PHBIHPYIFICAFL-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |