C39H50N2O3 — CID 19822335
2-[4-[(5,7-diheptyl-6-oxo-2-propylcyclohepta[d]imidazol-3-yl)methyl]phenyl]benzoic acid (PubChem CID 19822335) has the molecular formula C39H50N2O3 and a molecular weight of 594.84 g/mol. Its IUPAC name is 2-[4-[(5,7-diheptyl-6-oxo-2-propylcyclohepta[d]imidazol-3-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(5,7-diheptyl-6-oxo-2-propylcyclohepta[d]imidazol-3-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19822335 |
| Molecular Formula | C39H50N2O3 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.38 |
| IUPAC Name | 2-[4-[(5,7-diheptyl-6-oxo-2-propylcyclohepta[d]imidazol-3-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCCCCc1cc2nc(CCC)n(Cc3ccc(-c4ccccc4C(=O)O)cc3)c2cc(CCCCCCC)c1=O |
| InChI | InChI=1S/C39H50N2O3/c1-4-7-9-11-13-18-31-26-35-36(27-32(38(31)42)19-14-12-10-8-5-2)41(37(40-35)17-6-3)28-29-22-24-30(25-23-29)33-20-15-16-21-34(33)39(43)44/h15-16,20-27H,4-14,17-19,28H2,1-3H3,(H,43,44) |
| InChIKey | UCWNHYVCTPDDLU-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|