C32H28N4O2 — CID 10051708
2-[4-[[6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 10051708) has the molecular formula C32H28N4O2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[4-[[6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 10051708 |
| Molecular Formula | C32H28N4O2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-[4-[[6-(1-methylbenzimidazol-2-yl)-2-propylbenzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCCc1nc2ccc(-c3nc4ccccc4n3C)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C32H28N4O2/c1-3-8-30-33-27-18-17-23(31-34-26-11-6-7-12-28(26)35(31)2)19-29(27)36(30)20-21-13-15-22(16-14-21)24-9-4-5-10-25(24)32(37)38/h4-7,9-19H,3,8,20H2,1-2H3,(H,37,38) |
| InChIKey | MPBWDDNKHWTFRB-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |