C33H32ClN5O2 — CID 174855480
CID 174855480 (PubChem CID 174855480) has the molecular formula C33H32ClN5O2 and a molecular weight of 566.11 g/mol.
| Compound Name | CID 174855480 |
|---|---|
| PubChem CID | 174855480 |
| Molecular Formula | C33H32ClN5O2 |
| Molecular Weight | 566.11 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | — |
| SMILES | CCCc1nc2c(C)cc(-c3nc4ccccc4n3C)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1.NCl |
| InChI | InChI=1S/C33H30N4O2.ClH2N/c1-4-9-30-35-31-21(2)18-24(32-34-27-12-7-8-13-28(27)36(32)3)19-29(31)37(30)20-22-14-16-23(17-15-22)25-10-5-6-11-26(25)33(38)39;1-2/h5-8,10-19H,4,9,20H2,1-3H3,(H,38,39);2H2 |
| InChIKey | BAGSMAXYQHSZME-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.11 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|