C27H26N2O3 — CID 54450185
methyl 2-butyl-3-[[4-(2-formylphenyl)phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 54450185) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is methyl 2-butyl-3-[[4-(2-formylphenyl)phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | methyl 2-butyl-3-[[4-(2-formylphenyl)phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 54450185 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | methyl 2-butyl-3-[[4-(2-formylphenyl)phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCCCc1nc2cccc(C(=O)OC)c2n1Cc1ccc(-c2ccccc2C=O)cc1 |
| InChI | InChI=1S/C27H26N2O3/c1-3-4-12-25-28-24-11-7-10-23(27(31)32-2)26(24)29(25)17-19-13-15-20(16-14-19)22-9-6-5-8-21(22)18-30/h5-11,13-16,18H,3-4,12,17H2,1-2H3 |
| InChIKey | WUKKECSECUGOPZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|