C31H37N5O2 — CID 143894659
ethane;methyl 2-butyl-3-[[4-[2-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 143894659) has the molecular formula C31H37N5O2 and a molecular weight of 511.67 g/mol. Its IUPAC name is ethane;methyl 2-butyl-3-[[4-[2-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | ethane;methyl 2-butyl-3-[[4-[2-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 143894659 |
| Molecular Formula | C31H37N5O2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | ethane;methyl 2-butyl-3-[[4-[2-[1-(2-methyliminohydrazinyl)ethenyl]phenyl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | C=C(N/N=N/C)c1ccccc1-c1ccc(Cn2c(CCCC)nc3cccc(C(=O)OC)c32)cc1.CC |
| InChI | InChI=1S/C29H31N5O2.C2H6/c1-5-6-14-27-31-26-13-9-12-25(29(35)36-4)28(26)34(27)19-21-15-17-22(18-16-21)24-11-8-7-10-23(24)20(2)32-33-30-3;1-2/h7-13,15-18H,2,5-6,14,19H2,1,3-4H3,(H,30,32);1-2H3 |
| InChIKey | IUUUHUDUZAMWOM-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|